C23H23ClN6O — CID 56946692
9-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one (PubChem CID 56946692) has the molecular formula C23H23ClN6O and a molecular weight of 434.93 g/mol. Its IUPAC name is 9-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one.
| Compound Name | 9-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one |
|---|---|
| PubChem CID | 56946692 |
| Molecular Formula | C23H23ClN6O |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 9-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4c(n3)-c3ccc(Cl)cc3NC(=O)C4)cc2)CC1 |
| InChI | InChI=1S/C23H23ClN6O/c1-29-8-10-30(11-9-29)18-5-3-17(4-6-18)26-23-25-14-15-12-21(31)27-20-13-16(24)2-7-19(20)22(15)28-23/h2-7,13-14H,8-12H2,1H3,(H,27,31)(H,25,26,28) |
| InChIKey | LIXHSYCKAGJUFP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|