C25H30ClN7O2S — CID 56946730
N-[6-chloro-17-(4-methylpiperazin-1-yl)-2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(20),3,5,7(22),9,11,13(21),16,18-nonaen-10-yl]-N-methylmethanesulfonamide (PubChem CID 56946730) has the molecular formula C25H30ClN7O2S and a molecular weight of 528.08 g/mol. Its IUPAC name is N-[6-chloro-17-(4-methylpiperazin-1-yl)-2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(20),3,5,7(22),9,11,13(21),16,18-nonaen-10-yl]-N-methylmethanesulfonamide.
| Compound Name | N-[6-chloro-17-(4-methylpiperazin-1-yl)-2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(20),3,5,7(22),9,11,13(21),16,18-nonaen-10-yl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 56946730 |
| Molecular Formula | C25H30ClN7O2S |
| Molecular Weight | 528.08 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | N-[6-chloro-17-(4-methylpiperazin-1-yl)-2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(20),3,5,7(22),9,11,13(21),16,18-nonaen-10-yl]-N-methylmethanesulfonamide |
| SMILES | CN1CCN(c2ccc3cc2CCc2ccc(N(C)S(C)(=O)=O)c(c2)Nc2nc(ncc2Cl)N3)CC1 |
| InChI | InChI=1S/C25H30ClN7O2S/c1-31-10-12-33(13-11-31)22-9-7-19-15-18(22)6-4-17-5-8-23(32(2)36(3,34)35)21(14-17)29-24-20(26)16-27-25(28-19)30-24/h5,7-9,14-16H,4,6,10-13H2,1-3H3,(H2,27,28,29,30) |
| InChIKey | VPIYVBWLZFYYNW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.08 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|