C23H20N2O8 — CID 56946835
N-[4-(1,3-benzodioxol-5-yl)-2-nitrophenyl]-3,4,5-trimethoxybenzamide (PubChem CID 56946835) has the molecular formula C23H20N2O8 and a molecular weight of 452.42 g/mol. Its IUPAC name is N-[4-(1,3-benzodioxol-5-yl)-2-nitrophenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[4-(1,3-benzodioxol-5-yl)-2-nitrophenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 56946835 |
| Molecular Formula | C23H20N2O8 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | N-[4-(1,3-benzodioxol-5-yl)-2-nitrophenyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(-c3ccc4c(c3)OCO4)cc2[N+](=O)[O-])cc(OC)c1OC |
| InChI | InChI=1S/C23H20N2O8/c1-29-20-10-15(11-21(30-2)22(20)31-3)23(26)24-16-6-4-13(8-17(16)25(27)28)14-5-7-18-19(9-14)33-12-32-18/h4-11H,12H2,1-3H3,(H,24,26) |
| InChIKey | DWRMVYZPAROPSM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 118.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|