C18H19NO6PS-3 — CID 56947058
4-(9-ethylcarbazol-3-yl)-1-phosphonatobutane-1-sulfonate (PubChem CID 56947058) has the molecular formula C18H19NO6PS-3 and a molecular weight of 408.39 g/mol. Its IUPAC name is 4-(9-ethylcarbazol-3-yl)-1-phosphonatobutane-1-sulfonate.
| Compound Name | 4-(9-ethylcarbazol-3-yl)-1-phosphonatobutane-1-sulfonate |
|---|---|
| PubChem CID | 56947058 |
| Molecular Formula | C18H19NO6PS-3 |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 4-(9-ethylcarbazol-3-yl)-1-phosphonatobutane-1-sulfonate |
| SMILES | CCn1c2ccccc2c2cc(CCCC(P(=O)([O-])[O-])S(=O)(=O)[O-])ccc21 |
| InChI | InChI=1S/C18H22NO6PS/c1-2-19-16-8-4-3-7-14(16)15-12-13(10-11-17(15)19)6-5-9-18(26(20,21)22)27(23,24)25/h3-4,7-8,10-12,18H,2,5-6,9H2,1H3,(H2,20,21,22)(H,23,24,25)/p-3 |
| InChIKey | ZZMVEURNXXVJQQ-UHFFFAOYSA-K |
| XLogP | 1.92 |
| TPSA | 125.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|