About cobalt;2-deuterioporphyrin
cobalt;2-deuterioporphyrin (PubChem CID 56947292) has the molecular formula C20H12CoN4
and a molecular weight of 368.28 g/mol. Its IUPAC name is cobalt;2-deuterioporphyrin.
Molecular Properties
| Compound Name | cobalt;2-deuterioporphyrin |
| PubChem CID | 56947292 |
| Molecular Formula | C20H12CoN4 |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | cobalt;2-deuterioporphyrin |
| SMILES | [2H]C1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N\C(=C/2)C=C4)C=C3)C=C1.[Co] |
| InChI | InChI=1S/C20H12N4.Co/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;/h1-12H;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;/i1D; |
| InChIKey | AASDGEPFTXFDIU-NTODGFBASA-N |
| XLogP | 3.58 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cobalt;2-deuterioporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;2-deuterioporphyrin?
The IUPAC name of cobalt;2-deuterioporphyrin (CID 56947292) is cobalt;2-deuterioporphyrin.
What is the SMILES notation for cobalt;2-deuterioporphyrin?
The canonical SMILES for cobalt;2-deuterioporphyrin is [2H]C1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N\C(=C/2)C=C4)C=C3)C=C1.[Co].
What is the InChIKey of cobalt;2-deuterioporphyrin?
The InChIKey is AASDGEPFTXFDIU-NTODGFBASA-N. The full InChI is InChI=1S/C20H12N4.Co/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;/h1-12H;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;/i1D;.
What are the key properties of cobalt;2-deuterioporphyrin?
cobalt;2-deuterioporphyrin has a molecular weight of 368.28 g/mol, XLogP of 3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;2-deuterioporphyrin is sourced from PubChem (CID 56947292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).