C15H21F3N4O — CID 56947464
(E)-N-[2-[(5-ethyl-6-methylpyrimidin-4-yl)amino]butyl]-4,4,4-trifluorobut-2-enamide (PubChem CID 56947464) has the molecular formula C15H21F3N4O and a molecular weight of 330.35 g/mol. Its IUPAC name is (E)-N-[2-[(5-ethyl-6-methylpyrimidin-4-yl)amino]butyl]-4,4,4-trifluorobut-2-enamide.
| Compound Name | (E)-N-[2-[(5-ethyl-6-methylpyrimidin-4-yl)amino]butyl]-4,4,4-trifluorobut-2-enamide |
|---|---|
| PubChem CID | 56947464 |
| Molecular Formula | C15H21F3N4O |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (E)-N-[2-[(5-ethyl-6-methylpyrimidin-4-yl)amino]butyl]-4,4,4-trifluorobut-2-enamide |
| SMILES | CCc1c(C)ncnc1NC(CC)CNC(=O)/C=C/C(F)(F)F |
| InChI | InChI=1S/C15H21F3N4O/c1-4-11(8-19-13(23)6-7-15(16,17)18)22-14-12(5-2)10(3)20-9-21-14/h6-7,9,11H,4-5,8H2,1-3H3,(H,19,23)(H,20,21,22)/b7-6+ |
| InChIKey | UIOAXHSAJSQXSQ-VOTSOKGWSA-N |
| XLogP | 2.77 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|