C22H21F2N3O4 — CID 56947700
(4aS,10R,10aS)-2'-amino-8-[3-(difluoromethoxy)phenyl]-3'-methylspiro[3,4,4a,10a-tetrahydro-1H-pyrano[4,3-b]chromene-10,5'-imidazole]-4'-one (PubChem CID 56947700) has the molecular formula C22H21F2N3O4 and a molecular weight of 429.42 g/mol. Its IUPAC name is (4aS,10R,10aS)-2'-amino-8-[3-(difluoromethoxy)phenyl]-3'-methylspiro[3,4,4a,10a-tetrahydro-1H-pyrano[4,3-b]chromene-10,5'-imidazole]-4'-one.
| Compound Name | (4aS,10R,10aS)-2'-amino-8-[3-(difluoromethoxy)phenyl]-3'-methylspiro[3,4,4a,10a-tetrahydro-1H-pyrano[4,3-b]chromene-10,5'-imidazole]-4'-one |
|---|---|
| PubChem CID | 56947700 |
| Molecular Formula | C22H21F2N3O4 |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | (4aS,10R,10aS)-2'-amino-8-[3-(difluoromethoxy)phenyl]-3'-methylspiro[3,4,4a,10a-tetrahydro-1H-pyrano[4,3-b]chromene-10,5'-imidazole]-4'-one |
| SMILES | CN1C(=O)[C@]2(N=C1N)c1cc(-c3cccc(OC(F)F)c3)ccc1O[C@H]1CCOC[C@@H]12 |
| InChI | InChI=1S/C22H21F2N3O4/c1-27-19(28)22(26-21(27)25)15-10-13(12-3-2-4-14(9-12)30-20(23)24)5-6-17(15)31-18-7-8-29-11-16(18)22/h2-6,9-10,16,18,20H,7-8,11H2,1H3,(H2,25,26)/t16-,18-,22-/m0/s1 |
| InChIKey | QERRFQSEWKUWKZ-ZJBJCVSYSA-N |
| XLogP | 2.73 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |