C30H30N6O4 — CID 56947885
N-[[5-[4-(benzotriazol-1-ylmethoxy)phenyl]-1,3,4-oxadiazol-2-yl]methyl]-2-oxo-8-phenyloctanamide (PubChem CID 56947885) has the molecular formula C30H30N6O4 and a molecular weight of 538.61 g/mol. Its IUPAC name is N-[[5-[4-(benzotriazol-1-ylmethoxy)phenyl]-1,3,4-oxadiazol-2-yl]methyl]-2-oxo-8-phenyloctanamide.
| Compound Name | N-[[5-[4-(benzotriazol-1-ylmethoxy)phenyl]-1,3,4-oxadiazol-2-yl]methyl]-2-oxo-8-phenyloctanamide |
|---|---|
| PubChem CID | 56947885 |
| Molecular Formula | C30H30N6O4 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | N-[[5-[4-(benzotriazol-1-ylmethoxy)phenyl]-1,3,4-oxadiazol-2-yl]methyl]-2-oxo-8-phenyloctanamide |
| SMILES | O=C(CCCCCCc1ccccc1)C(=O)NCc1nnc(-c2ccc(OCn3nnc4ccccc43)cc2)o1 |
| InChI | InChI=1S/C30H30N6O4/c37-27(15-7-2-1-4-10-22-11-5-3-6-12-22)29(38)31-20-28-33-34-30(40-28)23-16-18-24(19-17-23)39-21-36-26-14-9-8-13-25(26)32-35-36/h3,5-6,8-9,11-14,16-19H,1-2,4,7,10,15,20-21H2,(H,31,38) |
| InChIKey | WCMSCCNPCMWOLH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 125.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|