C29H29FN4O4 — CID 56948129
N-[[5-[4-[(6-fluoro-2-pyridinyl)methoxy]phenyl]-1,3,4-oxadiazol-2-yl]methyl]-2-oxo-8-phenyloctanamide (PubChem CID 56948129) has the molecular formula C29H29FN4O4 and a molecular weight of 516.57 g/mol. Its IUPAC name is N-[[5-[4-[(6-fluoro-2-pyridinyl)methoxy]phenyl]-1,3,4-oxadiazol-2-yl]methyl]-2-oxo-8-phenyloctanamide.
| Compound Name | N-[[5-[4-[(6-fluoro-2-pyridinyl)methoxy]phenyl]-1,3,4-oxadiazol-2-yl]methyl]-2-oxo-8-phenyloctanamide |
|---|---|
| PubChem CID | 56948129 |
| Molecular Formula | C29H29FN4O4 |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | N-[[5-[4-[(6-fluoro-2-pyridinyl)methoxy]phenyl]-1,3,4-oxadiazol-2-yl]methyl]-2-oxo-8-phenyloctanamide |
| SMILES | O=C(CCCCCCc1ccccc1)C(=O)NCc1nnc(-c2ccc(OCc3cccc(F)n3)cc2)o1 |
| InChI | InChI=1S/C29H29FN4O4/c30-26-14-8-12-23(32-26)20-37-24-17-15-22(16-18-24)29-34-33-27(38-29)19-31-28(36)25(35)13-7-2-1-4-9-21-10-5-3-6-11-21/h3,5-6,8,10-12,14-18H,1-2,4,7,9,13,19-20H2,(H,31,36) |
| InChIKey | OPGQRVLKPSLADX-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|