About (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]decan-2-amine
(2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]decan-2-amine (PubChem CID 56948273) has the molecular formula C28H55NO
and a molecular weight of 421.75 g/mol. Its IUPAC name is (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]decan-2-amine.
Molecular Properties
| Compound Name | (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]decan-2-amine |
| PubChem CID | 56948273 |
| Molecular Formula | C28H55NO |
| Molecular Weight | 421.75 g/mol |
| Exact Mass | 421.43 |
| IUPAC Name | (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]decan-2-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC[C@@H](N)CCCCCCCC |
| InChI | InChI=1S/C28H55NO/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-22-24-26-30-27-28(29)25-23-21-10-8-6-4-2/h11-12,14-15,28H,3-10,13,16-27,29H2,1-2H3/b12-11-,15-14-/t28-/m0/s1 |
| InChIKey | IDQWWQMNLCJWBS-HAYDYOOHSA-N |
| XLogP | 8.89 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.75 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]decan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]decan-2-amine?
The IUPAC name of (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]decan-2-amine (CID 56948273) is (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]decan-2-amine.
What is the SMILES notation for (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]decan-2-amine?
The canonical SMILES for (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]decan-2-amine is CCCCC/C=C\C/C=C\CCCCCCCCOC[C@@H](N)CCCCCCCC.
What is the InChIKey of (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]decan-2-amine?
The InChIKey is IDQWWQMNLCJWBS-HAYDYOOHSA-N. The full InChI is InChI=1S/C28H55NO/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-22-24-26-30-27-28(29)25-23-21-10-8-6-4-2/h11-12,14-15,28H,3-10,13,16-27,29H2,1-2H3/b12-11-,15-14-/t28-/m0/s1.
What are the key properties of (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]decan-2-amine?
(2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]decan-2-amine has a molecular weight of 421.75 g/mol, XLogP of 8.89, 24 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]decan-2-amine is sourced from PubChem (CID 56948273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).