About (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]nonan-2-amine
(2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]nonan-2-amine (PubChem CID 56948274) has the molecular formula C27H53NO
and a molecular weight of 407.73 g/mol. Its IUPAC name is (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]nonan-2-amine.
Molecular Properties
| Compound Name | (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]nonan-2-amine |
| PubChem CID | 56948274 |
| Molecular Formula | C27H53NO |
| Molecular Weight | 407.73 g/mol |
| Exact Mass | 407.41 |
| IUPAC Name | (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]nonan-2-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC[C@@H](N)CCCCCCC |
| InChI | InChI=1S/C27H53NO/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-21-23-25-29-26-27(28)24-22-20-8-6-4-2/h10-11,13-14,27H,3-9,12,15-26,28H2,1-2H3/b11-10-,14-13-/t27-/m0/s1 |
| InChIKey | WJRICJOXJVMRCU-JNGRSSDXSA-N |
| XLogP | 8.50 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.73 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]nonan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]nonan-2-amine?
The IUPAC name of (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]nonan-2-amine (CID 56948274) is (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]nonan-2-amine.
What is the SMILES notation for (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]nonan-2-amine?
The canonical SMILES for (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]nonan-2-amine is CCCCC/C=C\C/C=C\CCCCCCCCOC[C@@H](N)CCCCCCC.
What is the InChIKey of (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]nonan-2-amine?
The InChIKey is WJRICJOXJVMRCU-JNGRSSDXSA-N. The full InChI is InChI=1S/C27H53NO/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-21-23-25-29-26-27(28)24-22-20-8-6-4-2/h10-11,13-14,27H,3-9,12,15-26,28H2,1-2H3/b11-10-,14-13-/t27-/m0/s1.
What are the key properties of (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]nonan-2-amine?
(2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]nonan-2-amine has a molecular weight of 407.73 g/mol, XLogP of 8.50, 23 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]nonan-2-amine is sourced from PubChem (CID 56948274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).