About 2-[bis(2-hydroxyethyl)amino]ethanol;(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate
2-[bis(2-hydroxyethyl)amino]ethanol;(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate (PubChem CID 56948394) has the molecular formula C22H37NO6
and a molecular weight of 411.54 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate |
| PubChem CID | 56948394 |
| Molecular Formula | C22H37NO6 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate |
| SMILES | CC1CC(OC(=O)c2ccccc2O)CC(C)(C)C1.OCCN(CCO)CCO |
| InChI | InChI=1S/C16H22O3.C6H15NO3/c1-11-8-12(10-16(2,3)9-11)19-15(18)13-6-4-5-7-14(13)17;8-4-1-7(2-5-9)3-6-10/h4-7,11-12,17H,8-10H2,1-3H3;8-10H,1-6H2 |
| InChIKey | OZWVYVKXKWVKSK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[bis(2-hydroxyethyl)amino]ethanol;(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate?
The IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate (CID 56948394) is 2-[bis(2-hydroxyethyl)amino]ethanol;(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate.
What is the SMILES notation for 2-[bis(2-hydroxyethyl)amino]ethanol;(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate?
The canonical SMILES for 2-[bis(2-hydroxyethyl)amino]ethanol;(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate is CC1CC(OC(=O)c2ccccc2O)CC(C)(C)C1.OCCN(CCO)CCO.
What is the InChIKey of 2-[bis(2-hydroxyethyl)amino]ethanol;(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate?
The InChIKey is OZWVYVKXKWVKSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O3.C6H15NO3/c1-11-8-12(10-16(2,3)9-11)19-15(18)13-6-4-5-7-14(13)17;8-4-1-7(2-5-9)3-6-10/h4-7,11-12,17H,8-10H2,1-3H3;8-10H,1-6H2.
What are the key properties of 2-[bis(2-hydroxyethyl)amino]ethanol;(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate?
2-[bis(2-hydroxyethyl)amino]ethanol;(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate has a molecular weight of 411.54 g/mol, XLogP of 2.03, 8 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethyl)amino]ethanol;(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate is sourced from PubChem (CID 56948394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).