C30H59NO — CID 56948402
(2S)-N,N-dimethyl-1-[(9Z,12Z)-octadeca-9,12-dienoxy]decan-2-amine (PubChem CID 56948402) has the molecular formula C30H59NO and a molecular weight of 449.81 g/mol. Its IUPAC name is (2S)-N,N-dimethyl-1-[(9Z,12Z)-octadeca-9,12-dienoxy]decan-2-amine.
| Compound Name | (2S)-N,N-dimethyl-1-[(9Z,12Z)-octadeca-9,12-dienoxy]decan-2-amine |
|---|---|
| PubChem CID | 56948402 |
| Molecular Formula | C30H59NO |
| Molecular Weight | 449.81 g/mol |
| Exact Mass | 449.46 |
| IUPAC Name | (2S)-N,N-dimethyl-1-[(9Z,12Z)-octadeca-9,12-dienoxy]decan-2-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC[C@H](CCCCCCCC)N(C)C |
| InChI | InChI=1S/C30H59NO/c1-5-7-9-11-13-14-15-16-17-18-19-20-21-22-24-26-28-32-29-30(31(3)4)27-25-23-12-10-8-6-2/h13-14,16-17,30H,5-12,15,18-29H2,1-4H3/b14-13-,17-16-/t30-/m0/s1 |
| InChIKey | HHDFBLWWRQHZSG-SKILABHRSA-N |
| XLogP | 9.50 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.81 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|