C33H65NO — CID 56948403
(2R,12Z,15Z)-1-decoxy-N,N-dimethylhenicosa-12,15-dien-2-amine (PubChem CID 56948403) has the molecular formula C33H65NO and a molecular weight of 491.89 g/mol. Its IUPAC name is (2R,12Z,15Z)-1-decoxy-N,N-dimethylhenicosa-12,15-dien-2-amine.
| Compound Name | (2R,12Z,15Z)-1-decoxy-N,N-dimethylhenicosa-12,15-dien-2-amine |
|---|---|
| PubChem CID | 56948403 |
| Molecular Formula | C33H65NO |
| Molecular Weight | 491.89 g/mol |
| Exact Mass | 491.51 |
| IUPAC Name | (2R,12Z,15Z)-1-decoxy-N,N-dimethylhenicosa-12,15-dien-2-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC[C@H](COCCCCCCCCCC)N(C)C |
| InChI | InChI=1S/C33H65NO/c1-5-7-9-11-13-15-16-17-18-19-20-21-22-23-24-26-28-30-33(34(3)4)32-35-31-29-27-25-14-12-10-8-6-2/h13,15,17-18,33H,5-12,14,16,19-32H2,1-4H3/b15-13-,18-17-/t33-/m1/s1 |
| InChIKey | XQWHMSXQGSLQCA-QZOKZNFOSA-N |
| XLogP | 10.67 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.89 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|