C20H16Cl2F3NO3 — CID 56948559
(3R)-3-(3,5-dichlorophenyl)-4,4,4-trifluoro-3-hydroxy-1-[(1Z)-1-methoxyimino-2,3-dihydroinden-5-yl]butan-1-one (PubChem CID 56948559) has the molecular formula C20H16Cl2F3NO3 and a molecular weight of 446.25 g/mol. Its IUPAC name is (3R)-3-(3,5-dichlorophenyl)-4,4,4-trifluoro-3-hydroxy-1-[(1Z)-1-methoxyimino-2,3-dihydroinden-5-yl]butan-1-one.
| Compound Name | (3R)-3-(3,5-dichlorophenyl)-4,4,4-trifluoro-3-hydroxy-1-[(1Z)-1-methoxyimino-2,3-dihydroinden-5-yl]butan-1-one |
|---|---|
| PubChem CID | 56948559 |
| Molecular Formula | C20H16Cl2F3NO3 |
| Molecular Weight | 446.25 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | (3R)-3-(3,5-dichlorophenyl)-4,4,4-trifluoro-3-hydroxy-1-[(1Z)-1-methoxyimino-2,3-dihydroinden-5-yl]butan-1-one |
| SMILES | CO/N=C1/CCc2cc(C(=O)C[C@@](O)(c3cc(Cl)cc(Cl)c3)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C20H16Cl2F3NO3/c1-29-26-17-5-3-11-6-12(2-4-16(11)17)18(27)10-19(28,20(23,24)25)13-7-14(21)9-15(22)8-13/h2,4,6-9,28H,3,5,10H2,1H3/b26-17-/t19-/m1/s1 |
| InChIKey | VODHGWUSHHNIDT-FDRCZSESSA-N |
| XLogP | 5.31 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.25 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|