C21H19ClFN3O3 — CID 56948806
(4aS,10R,10aS)-2'-amino-8-(3-chloro-5-fluorophenyl)-3'-methylspiro[3,4,4a,10a-tetrahydro-1H-pyrano[4,3-b]chromene-10,5'-imidazole]-4'-one (PubChem CID 56948806) has the molecular formula C21H19ClFN3O3 and a molecular weight of 415.85 g/mol. Its IUPAC name is (4aS,10R,10aS)-2'-amino-8-(3-chloro-5-fluorophenyl)-3'-methylspiro[3,4,4a,10a-tetrahydro-1H-pyrano[4,3-b]chromene-10,5'-imidazole]-4'-one.
| Compound Name | (4aS,10R,10aS)-2'-amino-8-(3-chloro-5-fluorophenyl)-3'-methylspiro[3,4,4a,10a-tetrahydro-1H-pyrano[4,3-b]chromene-10,5'-imidazole]-4'-one |
|---|---|
| PubChem CID | 56948806 |
| Molecular Formula | C21H19ClFN3O3 |
| Molecular Weight | 415.85 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | (4aS,10R,10aS)-2'-amino-8-(3-chloro-5-fluorophenyl)-3'-methylspiro[3,4,4a,10a-tetrahydro-1H-pyrano[4,3-b]chromene-10,5'-imidazole]-4'-one |
| SMILES | CN1C(=O)[C@]2(N=C1N)c1cc(-c3cc(F)cc(Cl)c3)ccc1O[C@H]1CCOC[C@@H]12 |
| InChI | InChI=1S/C21H19ClFN3O3/c1-26-19(27)21(25-20(26)24)15-8-11(12-6-13(22)9-14(23)7-12)2-3-17(15)29-18-4-5-28-10-16(18)21/h2-3,6-9,16,18H,4-5,10H2,1H3,(H2,24,25)/t16-,18-,21-/m0/s1 |
| InChIKey | PXWMFIUSWQAUPD-MDKPJZGXSA-N |
| XLogP | 2.93 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.85 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |