About CID 56948919
CID 56948919 (PubChem CID 56948919) has the molecular formula C24H23ClFN3O4
and a molecular weight of 471.92 g/mol.
Molecular Properties
| Compound Name | CID 56948919 |
| PubChem CID | 56948919 |
| Molecular Formula | C24H23ClFN3O4 |
| Molecular Weight | 471.92 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | — |
| SMILES | CN1C(=O)C2(N=C1N)c1cc(-c3cc(F)cc(Cl)c3)ccc1OC1CC3(CCC12)OCCO3 |
| InChI | InChI=1S/C24H23ClFN3O4/c1-29-21(30)24(28-22(29)27)17-4-5-23(31-6-7-32-23)12-20(17)33-19-3-2-13(10-18(19)24)14-8-15(25)11-16(26)9-14/h2-3,8-11,17,20H,4-7,12H2,1H3,(H2,27,28) |
| InChIKey | GASCBKZEMHMOMO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.92 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 56948919 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 56948919?
The IUPAC name of CID 56948919 (CID 56948919) is not available.
What is the SMILES notation for CID 56948919?
The canonical SMILES for CID 56948919 is CN1C(=O)C2(N=C1N)c1cc(-c3cc(F)cc(Cl)c3)ccc1OC1CC3(CCC12)OCCO3.
What is the InChIKey of CID 56948919?
The InChIKey is GASCBKZEMHMOMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23ClFN3O4/c1-29-21(30)24(28-22(29)27)17-4-5-23(31-6-7-32-23)12-20(17)33-19-3-2-13(10-18(19)24)14-8-15(25)11-16(26)9-14/h2-3,8-11,17,20H,4-7,12H2,1H3,(H2,27,28).
What are the key properties of CID 56948919?
CID 56948919 has a molecular weight of 471.92 g/mol, XLogP of 3.43, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 56948919 is sourced from PubChem (CID 56948919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).