C22H21ClFN3O2 — CID 56949032
(4aS,9aR)-2'-amino-7-(3-chloro-5-fluorophenyl)-3'-methylspiro[1,2,3,4,4a,9a-hexahydroxanthene-9,5'-imidazole]-4'-one (PubChem CID 56949032) has the molecular formula C22H21ClFN3O2 and a molecular weight of 413.88 g/mol. Its IUPAC name is (4aS,9aR)-2'-amino-7-(3-chloro-5-fluorophenyl)-3'-methylspiro[1,2,3,4,4a,9a-hexahydroxanthene-9,5'-imidazole]-4'-one.
| Compound Name | (4aS,9aR)-2'-amino-7-(3-chloro-5-fluorophenyl)-3'-methylspiro[1,2,3,4,4a,9a-hexahydroxanthene-9,5'-imidazole]-4'-one |
|---|---|
| PubChem CID | 56949032 |
| Molecular Formula | C22H21ClFN3O2 |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | (4aS,9aR)-2'-amino-7-(3-chloro-5-fluorophenyl)-3'-methylspiro[1,2,3,4,4a,9a-hexahydroxanthene-9,5'-imidazole]-4'-one |
| SMILES | CN1C(=O)C2(N=C1N)c1cc(-c3cc(F)cc(Cl)c3)ccc1O[C@H]1CCCC[C@@H]12 |
| InChI | InChI=1S/C22H21ClFN3O2/c1-27-20(28)22(26-21(27)25)16-4-2-3-5-18(16)29-19-7-6-12(10-17(19)22)13-8-14(23)11-15(24)9-13/h6-11,16,18H,2-5H2,1H3,(H2,25,26)/t16-,18-,22?/m0/s1 |
| InChIKey | YWPOXSWXAHUXDP-XJKSGNHDSA-N |
| XLogP | 4.08 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |