About (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl pyridin-2-yl carbonate
(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl pyridin-2-yl carbonate (PubChem CID 56949258) has the molecular formula C11H9NO6
and a molecular weight of 251.19 g/mol. Its IUPAC name is (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl pyridin-2-yl carbonate.
Molecular Properties
| Compound Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl pyridin-2-yl carbonate |
| PubChem CID | 56949258 |
| Molecular Formula | C11H9NO6 |
| Molecular Weight | 251.19 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl pyridin-2-yl carbonate |
| SMILES | Cc1oc(=O)oc1COC(=O)Oc1ccccn1 |
| InChI | InChI=1S/C11H9NO6/c1-7-8(17-11(14)16-7)6-15-10(13)18-9-4-2-3-5-12-9/h2-5H,6H2,1H3 |
| InChIKey | QLTMZAIPPISLGA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 91.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.19 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl pyridin-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl pyridin-2-yl carbonate?
The IUPAC name of (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl pyridin-2-yl carbonate (CID 56949258) is (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl pyridin-2-yl carbonate.
What is the SMILES notation for (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl pyridin-2-yl carbonate?
The canonical SMILES for (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl pyridin-2-yl carbonate is Cc1oc(=O)oc1COC(=O)Oc1ccccn1.
What is the InChIKey of (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl pyridin-2-yl carbonate?
The InChIKey is QLTMZAIPPISLGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO6/c1-7-8(17-11(14)16-7)6-15-10(13)18-9-4-2-3-5-12-9/h2-5H,6H2,1H3.
What are the key properties of (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl pyridin-2-yl carbonate?
(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl pyridin-2-yl carbonate has a molecular weight of 251.19 g/mol, XLogP of 1.65, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl pyridin-2-yl carbonate is sourced from PubChem (CID 56949258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).