C17H14F5NO2S — CID 56949381
[5-[(2,3,4,5,6-pentafluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] propanoate (PubChem CID 56949381) has the molecular formula C17H14F5NO2S and a molecular weight of 391.36 g/mol. Its IUPAC name is [5-[(2,3,4,5,6-pentafluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] propanoate.
| Compound Name | [5-[(2,3,4,5,6-pentafluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] propanoate |
|---|---|
| PubChem CID | 56949381 |
| Molecular Formula | C17H14F5NO2S |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | [5-[(2,3,4,5,6-pentafluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] propanoate |
| SMILES | CCC(=O)Oc1cc2c(s1)CCN(Cc1c(F)c(F)c(F)c(F)c1F)C2 |
| InChI | InChI=1S/C17H14F5NO2S/c1-2-11(24)25-12-5-8-6-23(4-3-10(8)26-12)7-9-13(18)15(20)17(22)16(21)14(9)19/h5H,2-4,6-7H2,1H3 |
| InChIKey | GOHQHNBIHCAQTA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|