About [5-[(2-fluoro-4-methylphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] butanoate
[5-[(2-fluoro-4-methylphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] butanoate (PubChem CID 56949387) has the molecular formula C19H22FNO2S
and a molecular weight of 347.46 g/mol. Its IUPAC name is [5-[(2-fluoro-4-methylphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] butanoate.
Molecular Properties
| Compound Name | [5-[(2-fluoro-4-methylphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] butanoate |
| PubChem CID | 56949387 |
| Molecular Formula | C19H22FNO2S |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | [5-[(2-fluoro-4-methylphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] butanoate |
| SMILES | CCCC(=O)Oc1cc2c(s1)CCN(Cc1ccc(C)cc1F)C2 |
| InChI | InChI=1S/C19H22FNO2S/c1-3-4-18(22)23-19-10-15-12-21(8-7-17(15)24-19)11-14-6-5-13(2)9-16(14)20/h5-6,9-10H,3-4,7-8,11-12H2,1-2H3 |
| InChIKey | RLHCIQQLPSDVJE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-[(2-fluoro-4-methylphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(2-fluoro-4-methylphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] butanoate?
The IUPAC name of [5-[(2-fluoro-4-methylphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] butanoate (CID 56949387) is [5-[(2-fluoro-4-methylphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] butanoate.
What is the SMILES notation for [5-[(2-fluoro-4-methylphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] butanoate?
The canonical SMILES for [5-[(2-fluoro-4-methylphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] butanoate is CCCC(=O)Oc1cc2c(s1)CCN(Cc1ccc(C)cc1F)C2.
What is the InChIKey of [5-[(2-fluoro-4-methylphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] butanoate?
The InChIKey is RLHCIQQLPSDVJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22FNO2S/c1-3-4-18(22)23-19-10-15-12-21(8-7-17(15)24-19)11-14-6-5-13(2)9-16(14)20/h5-6,9-10H,3-4,7-8,11-12H2,1-2H3.
What are the key properties of [5-[(2-fluoro-4-methylphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] butanoate?
[5-[(2-fluoro-4-methylphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] butanoate has a molecular weight of 347.46 g/mol, XLogP of 4.46, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(2-fluoro-4-methylphenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] butanoate is sourced from PubChem (CID 56949387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).