C20H21F2N3O2 — CID 56949431
N-[2-(4-tert-butyl-3,5-difluorophenoxy)ethyl]pyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 56949431) has the molecular formula C20H21F2N3O2 and a molecular weight of 373.40 g/mol. Its IUPAC name is N-[2-(4-tert-butyl-3,5-difluorophenoxy)ethyl]pyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | N-[2-(4-tert-butyl-3,5-difluorophenoxy)ethyl]pyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56949431 |
| Molecular Formula | C20H21F2N3O2 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-[2-(4-tert-butyl-3,5-difluorophenoxy)ethyl]pyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | CC(C)(C)c1c(F)cc(OCCNC(=O)c2cnn3ccccc23)cc1F |
| InChI | InChI=1S/C20H21F2N3O2/c1-20(2,3)18-15(21)10-13(11-16(18)22)27-9-7-23-19(26)14-12-24-25-8-5-4-6-17(14)25/h4-6,8,10-12H,7,9H2,1-3H3,(H,23,26) |
| InChIKey | SDAKWMHNXUGINA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|