C19H30O17P2 — CID 56949696
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(E)-4-[hydroxy(phosphonooxy)phosphoryl]oxy-2-methylbut-2-enoxy]oxan-2-yl]methyl acetate (PubChem CID 56949696) has the molecular formula C19H30O17P2 and a molecular weight of 592.38 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(E)-4-[hydroxy(phosphonooxy)phosphoryl]oxy-2-methylbut-2-enoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(E)-4-[hydroxy(phosphonooxy)phosphoryl]oxy-2-methylbut-2-enoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 56949696 |
| Molecular Formula | C19H30O17P2 |
| Molecular Weight | 592.38 g/mol |
| Exact Mass | 592.10 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(E)-4-[hydroxy(phosphonooxy)phosphoryl]oxy-2-methylbut-2-enoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC/C(C)=C/COP(=O)(O)OP(=O)(O)O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H30O17P2/c1-10(6-7-31-38(27,28)36-37(24,25)26)8-30-19-18(34-14(5)23)17(33-13(4)22)16(32-12(3)21)15(35-19)9-29-11(2)20/h6,15-19H,7-9H2,1-5H3,(H,27,28)(H2,24,25,26)/b10-6+/t15-,16-,17+,18-,19-/m1/s1 |
| InChIKey | KBKMLLURPXFCLB-QAAFWDSISA-N |
| XLogP | 0.26 |
| TPSA | 236.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.38 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|