C33H47N3O5 — CID 56949708
(3S)-2-[(2E,4E)-hexa-2,4-dienoyl]-7-[2-[5-methyl-2-[(E)-5-methylhex-1-enyl]-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid;2-methylpropan-2-amine (PubChem CID 56949708) has the molecular formula C33H47N3O5 and a molecular weight of 565.76 g/mol. Its IUPAC name is (3S)-2-[(2E,4E)-hexa-2,4-dienoyl]-7-[2-[5-methyl-2-[(E)-5-methylhex-1-enyl]-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid;2-methylpropan-2-amine.
| Compound Name | (3S)-2-[(2E,4E)-hexa-2,4-dienoyl]-7-[2-[5-methyl-2-[(E)-5-methylhex-1-enyl]-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid;2-methylpropan-2-amine |
|---|---|
| PubChem CID | 56949708 |
| Molecular Formula | C33H47N3O5 |
| Molecular Weight | 565.76 g/mol |
| Exact Mass | 565.35 |
| IUPAC Name | (3S)-2-[(2E,4E)-hexa-2,4-dienoyl]-7-[2-[5-methyl-2-[(E)-5-methylhex-1-enyl]-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid;2-methylpropan-2-amine |
| SMILES | C/C=C/C=C/C(=O)N1Cc2cc(OCCc3nc(/C=C/CCC(C)C)oc3C)ccc2C[C@H]1C(=O)O.CC(C)(C)N |
| InChI | InChI=1S/C29H36N2O5.C4H11N/c1-5-6-7-12-28(32)31-19-23-17-24(14-13-22(23)18-26(31)29(33)34)35-16-15-25-21(4)36-27(30-25)11-9-8-10-20(2)3;1-4(2,3)5/h5-7,9,11-14,17,20,26H,8,10,15-16,18-19H2,1-4H3,(H,33,34);5H2,1-3H3/b6-5+,11-9+,12-7+;/t26-;/m0./s1 |
| InChIKey | FOLFRKHUARXLNX-AFBVSDSISA-N |
| XLogP | 6.27 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.76 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|