About N'-(1-cyclohexyl-2,3-dihydroindol-6-yl)thiophene-2-carboximidamide
N'-(1-cyclohexyl-2,3-dihydroindol-6-yl)thiophene-2-carboximidamide (PubChem CID 56949933) has the molecular formula C19H23N3S
and a molecular weight of 325.48 g/mol. Its IUPAC name is N'-(1-cyclohexyl-2,3-dihydroindol-6-yl)thiophene-2-carboximidamide.
Molecular Properties
| Compound Name | N'-(1-cyclohexyl-2,3-dihydroindol-6-yl)thiophene-2-carboximidamide |
| PubChem CID | 56949933 |
| Molecular Formula | C19H23N3S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | N'-(1-cyclohexyl-2,3-dihydroindol-6-yl)thiophene-2-carboximidamide |
| SMILES | N/C(=N\c1ccc2c(c1)N(C1CCCCC1)CC2)c1cccs1 |
| InChI | InChI=1S/C19H23N3S/c20-19(18-7-4-12-23-18)21-15-9-8-14-10-11-22(17(14)13-15)16-5-2-1-3-6-16/h4,7-9,12-13,16H,1-3,5-6,10-11H2,(H2,20,21) |
| InChIKey | MMLFTYMILUDDSF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(1-cyclohexyl-2,3-dihydroindol-6-yl)thiophene-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1-cyclohexyl-2,3-dihydroindol-6-yl)thiophene-2-carboximidamide?
The IUPAC name of N'-(1-cyclohexyl-2,3-dihydroindol-6-yl)thiophene-2-carboximidamide (CID 56949933) is N'-(1-cyclohexyl-2,3-dihydroindol-6-yl)thiophene-2-carboximidamide.
What is the SMILES notation for N'-(1-cyclohexyl-2,3-dihydroindol-6-yl)thiophene-2-carboximidamide?
The canonical SMILES for N'-(1-cyclohexyl-2,3-dihydroindol-6-yl)thiophene-2-carboximidamide is N/C(=N\c1ccc2c(c1)N(C1CCCCC1)CC2)c1cccs1.
What is the InChIKey of N'-(1-cyclohexyl-2,3-dihydroindol-6-yl)thiophene-2-carboximidamide?
The InChIKey is MMLFTYMILUDDSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3S/c20-19(18-7-4-12-23-18)21-15-9-8-14-10-11-22(17(14)13-15)16-5-2-1-3-6-16/h4,7-9,12-13,16H,1-3,5-6,10-11H2,(H2,20,21).
What are the key properties of N'-(1-cyclohexyl-2,3-dihydroindol-6-yl)thiophene-2-carboximidamide?
N'-(1-cyclohexyl-2,3-dihydroindol-6-yl)thiophene-2-carboximidamide has a molecular weight of 325.48 g/mol, XLogP of 4.48, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1-cyclohexyl-2,3-dihydroindol-6-yl)thiophene-2-carboximidamide is sourced from PubChem (CID 56949933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).