About N'-[1-(oxan-4-yl)-2,3-dihydroindol-6-yl]thiophene-2-carboximidamide
N'-[1-(oxan-4-yl)-2,3-dihydroindol-6-yl]thiophene-2-carboximidamide (PubChem CID 56949934) has the molecular formula C18H21N3OS
and a molecular weight of 327.45 g/mol. Its IUPAC name is N'-[1-(oxan-4-yl)-2,3-dihydroindol-6-yl]thiophene-2-carboximidamide.
Molecular Properties
| Compound Name | N'-[1-(oxan-4-yl)-2,3-dihydroindol-6-yl]thiophene-2-carboximidamide |
| PubChem CID | 56949934 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | N'-[1-(oxan-4-yl)-2,3-dihydroindol-6-yl]thiophene-2-carboximidamide |
| SMILES | N/C(=N\c1ccc2c(c1)N(C1CCOCC1)CC2)c1cccs1 |
| InChI | InChI=1S/C18H21N3OS/c19-18(17-2-1-11-23-17)20-14-4-3-13-5-8-21(16(13)12-14)15-6-9-22-10-7-15/h1-4,11-12,15H,5-10H2,(H2,19,20) |
| InChIKey | ALFFEMXVJSGMTD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[1-(oxan-4-yl)-2,3-dihydroindol-6-yl]thiophene-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[1-(oxan-4-yl)-2,3-dihydroindol-6-yl]thiophene-2-carboximidamide?
The IUPAC name of N'-[1-(oxan-4-yl)-2,3-dihydroindol-6-yl]thiophene-2-carboximidamide (CID 56949934) is N'-[1-(oxan-4-yl)-2,3-dihydroindol-6-yl]thiophene-2-carboximidamide.
What is the SMILES notation for N'-[1-(oxan-4-yl)-2,3-dihydroindol-6-yl]thiophene-2-carboximidamide?
The canonical SMILES for N'-[1-(oxan-4-yl)-2,3-dihydroindol-6-yl]thiophene-2-carboximidamide is N/C(=N\c1ccc2c(c1)N(C1CCOCC1)CC2)c1cccs1.
What is the InChIKey of N'-[1-(oxan-4-yl)-2,3-dihydroindol-6-yl]thiophene-2-carboximidamide?
The InChIKey is ALFFEMXVJSGMTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3OS/c19-18(17-2-1-11-23-17)20-14-4-3-13-5-8-21(16(13)12-14)15-6-9-22-10-7-15/h1-4,11-12,15H,5-10H2,(H2,19,20).
What are the key properties of N'-[1-(oxan-4-yl)-2,3-dihydroindol-6-yl]thiophene-2-carboximidamide?
N'-[1-(oxan-4-yl)-2,3-dihydroindol-6-yl]thiophene-2-carboximidamide has a molecular weight of 327.45 g/mol, XLogP of 3.33, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[1-(oxan-4-yl)-2,3-dihydroindol-6-yl]thiophene-2-carboximidamide is sourced from PubChem (CID 56949934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).