About 4-piperidin-1-yl-5,6-dihydrobenzo[h]quinazolin-2-amine
4-piperidin-1-yl-5,6-dihydrobenzo[h]quinazolin-2-amine (PubChem CID 56950109) has the molecular formula C17H20N4
and a molecular weight of 280.37 g/mol. Its IUPAC name is 4-piperidin-1-yl-5,6-dihydrobenzo[h]quinazolin-2-amine.
Molecular Properties
| Compound Name | 4-piperidin-1-yl-5,6-dihydrobenzo[h]quinazolin-2-amine |
| PubChem CID | 56950109 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 4-piperidin-1-yl-5,6-dihydrobenzo[h]quinazolin-2-amine |
| SMILES | Nc1nc2c(c(N3CCCCC3)n1)CCc1ccccc1-2 |
| InChI | InChI=1S/C17H20N4/c18-17-19-15-13-7-3-2-6-12(13)8-9-14(15)16(20-17)21-10-4-1-5-11-21/h2-3,6-7H,1,4-5,8-11H2,(H2,18,19,20) |
| InChIKey | WOTJWFYAOAXQQZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-piperidin-1-yl-5,6-dihydrobenzo[h]quinazolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperidin-1-yl-5,6-dihydrobenzo[h]quinazolin-2-amine?
The IUPAC name of 4-piperidin-1-yl-5,6-dihydrobenzo[h]quinazolin-2-amine (CID 56950109) is 4-piperidin-1-yl-5,6-dihydrobenzo[h]quinazolin-2-amine.
What is the SMILES notation for 4-piperidin-1-yl-5,6-dihydrobenzo[h]quinazolin-2-amine?
The canonical SMILES for 4-piperidin-1-yl-5,6-dihydrobenzo[h]quinazolin-2-amine is Nc1nc2c(c(N3CCCCC3)n1)CCc1ccccc1-2.
What is the InChIKey of 4-piperidin-1-yl-5,6-dihydrobenzo[h]quinazolin-2-amine?
The InChIKey is WOTJWFYAOAXQQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4/c18-17-19-15-13-7-3-2-6-12(13)8-9-14(15)16(20-17)21-10-4-1-5-11-21/h2-3,6-7H,1,4-5,8-11H2,(H2,18,19,20).
What are the key properties of 4-piperidin-1-yl-5,6-dihydrobenzo[h]quinazolin-2-amine?
4-piperidin-1-yl-5,6-dihydrobenzo[h]quinazolin-2-amine has a molecular weight of 280.37 g/mol, XLogP of 2.81, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperidin-1-yl-5,6-dihydrobenzo[h]quinazolin-2-amine is sourced from PubChem (CID 56950109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).