C26H38NO8P — CID 56950359
dimethyl 2-diethoxyphosphoryl-2-phenyl-5-(2,4,4-trimethylpentan-2-ylimino)furan-3,4-dicarboxylate (PubChem CID 56950359) has the molecular formula C26H38NO8P and a molecular weight of 523.56 g/mol. Its IUPAC name is dimethyl 2-diethoxyphosphoryl-2-phenyl-5-(2,4,4-trimethylpentan-2-ylimino)furan-3,4-dicarboxylate.
| Compound Name | dimethyl 2-diethoxyphosphoryl-2-phenyl-5-(2,4,4-trimethylpentan-2-ylimino)furan-3,4-dicarboxylate |
|---|---|
| PubChem CID | 56950359 |
| Molecular Formula | C26H38NO8P |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | dimethyl 2-diethoxyphosphoryl-2-phenyl-5-(2,4,4-trimethylpentan-2-ylimino)furan-3,4-dicarboxylate |
| SMILES | CCOP(=O)(OCC)C1(c2ccccc2)O/C(=N\C(C)(C)CC(C)(C)C)C(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C26H38NO8P/c1-10-33-36(30,34-11-2)26(18-15-13-12-14-16-18)20(23(29)32-9)19(22(28)31-8)21(35-26)27-25(6,7)17-24(3,4)5/h12-16H,10-11,17H2,1-9H3/b27-21- |
| InChIKey | SUCUFXRSOQOKMU-MEFGMAGPSA-N |
| XLogP | 5.39 |
| TPSA | 109.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|