C26H25FN4O9 — CID 56950431
N-[(5aR,6aS,7S,10aR)-9-carbamoyl-7-(dimethylamino)-4-fluoro-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 56950431) has the molecular formula C26H25FN4O9 and a molecular weight of 556.50 g/mol. Its IUPAC name is N-[(5aR,6aS,7S,10aR)-9-carbamoyl-7-(dimethylamino)-4-fluoro-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[(5aR,6aS,7S,10aR)-9-carbamoyl-7-(dimethylamino)-4-fluoro-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 56950431 |
| Molecular Formula | C26H25FN4O9 |
| Molecular Weight | 556.50 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | N-[(5aR,6aS,7S,10aR)-9-carbamoyl-7-(dimethylamino)-4-fluoro-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cc(F)c3c(c2O)C(O)=C2C(=O)[C@]4(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]4C[C@@H]2C3)no1 |
| InChI | InChI=1S/C26H25FN4O9/c1-8-4-14(30-40-8)25(38)29-13-7-12(27)10-5-9-6-11-18(31(2)3)21(34)17(24(28)37)23(36)26(11,39)22(35)15(9)20(33)16(10)19(13)32/h4,7,9,11,18,32-33,36,39H,5-6H2,1-3H3,(H2,28,37)(H,29,38)/t9-,11-,18-,26-/m0/s1 |
| InChIKey | HTNGRNWSCKLKOC-FEBLPKDSSA-N |
| XLogP | 0.65 |
| TPSA | 216.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.50 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|