C21H28O3 — CID 56950547
(11S)-7-methoxy-12,12-dimethyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),6-triene-4,5-dione (PubChem CID 56950547) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (11S)-7-methoxy-12,12-dimethyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),6-triene-4,5-dione.
| Compound Name | (11S)-7-methoxy-12,12-dimethyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),6-triene-4,5-dione |
|---|---|
| PubChem CID | 56950547 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (11S)-7-methoxy-12,12-dimethyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),6-triene-4,5-dione |
| SMILES | COC1=C(C(C)C)C(=O)C(=O)C2=C1CC[C@@H]1C(=CCCC1(C)C)C2 |
| InChI | InChI=1S/C21H28O3/c1-12(2)17-19(23)18(22)15-11-13-7-6-10-21(3,4)16(13)9-8-14(15)20(17)24-5/h7,12,16H,6,8-11H2,1-5H3/t16-/m1/s1 |
| InChIKey | JAYYCJMRHGVXSV-MRXNPFEDSA-N |
| XLogP | 4.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|