About [(2S)-oxiran-2-yl]methyl 2-(4-benzylphenyl)acetate
[(2S)-oxiran-2-yl]methyl 2-(4-benzylphenyl)acetate (PubChem CID 56950595) has the molecular formula C18H18O3
and a molecular weight of 282.34 g/mol. Its IUPAC name is [(2S)-oxiran-2-yl]methyl 2-(4-benzylphenyl)acetate.
Molecular Properties
| Compound Name | [(2S)-oxiran-2-yl]methyl 2-(4-benzylphenyl)acetate |
| PubChem CID | 56950595 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | [(2S)-oxiran-2-yl]methyl 2-(4-benzylphenyl)acetate |
| SMILES | O=C(Cc1ccc(Cc2ccccc2)cc1)OC[C@@H]1CO1 |
| InChI | InChI=1S/C18H18O3/c19-18(21-13-17-12-20-17)11-16-8-6-15(7-9-16)10-14-4-2-1-3-5-14/h1-9,17H,10-13H2/t17-/m0/s1 |
| InChIKey | AADKPDGTJHDJAJ-KRWDZBQOSA-N |
| XLogP | 2.76 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-oxiran-2-yl]methyl 2-(4-benzylphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-oxiran-2-yl]methyl 2-(4-benzylphenyl)acetate?
The IUPAC name of [(2S)-oxiran-2-yl]methyl 2-(4-benzylphenyl)acetate (CID 56950595) is [(2S)-oxiran-2-yl]methyl 2-(4-benzylphenyl)acetate.
What is the SMILES notation for [(2S)-oxiran-2-yl]methyl 2-(4-benzylphenyl)acetate?
The canonical SMILES for [(2S)-oxiran-2-yl]methyl 2-(4-benzylphenyl)acetate is O=C(Cc1ccc(Cc2ccccc2)cc1)OC[C@@H]1CO1.
What is the InChIKey of [(2S)-oxiran-2-yl]methyl 2-(4-benzylphenyl)acetate?
The InChIKey is AADKPDGTJHDJAJ-KRWDZBQOSA-N. The full InChI is InChI=1S/C18H18O3/c19-18(21-13-17-12-20-17)11-16-8-6-15(7-9-16)10-14-4-2-1-3-5-14/h1-9,17H,10-13H2/t17-/m0/s1.
What are the key properties of [(2S)-oxiran-2-yl]methyl 2-(4-benzylphenyl)acetate?
[(2S)-oxiran-2-yl]methyl 2-(4-benzylphenyl)acetate has a molecular weight of 282.34 g/mol, XLogP of 2.76, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-oxiran-2-yl]methyl 2-(4-benzylphenyl)acetate is sourced from PubChem (CID 56950595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).