C26H31FN4O9 — CID 56950833
(4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-9-[[2-(2-methoxyethylamino)acetyl]amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 56950833) has the molecular formula C26H31FN4O9 and a molecular weight of 562.55 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-9-[[2-(2-methoxyethylamino)acetyl]amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-9-[[2-(2-methoxyethylamino)acetyl]amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 56950833 |
| Molecular Formula | C26H31FN4O9 |
| Molecular Weight | 562.55 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-9-[[2-(2-methoxyethylamino)acetyl]amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | COCCNCC(=O)Nc1cc(F)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C26H31FN4O9/c1-31(2)19-12-7-10-6-11-13(27)8-14(30-15(32)9-29-4-5-40-3)20(33)17(11)21(34)16(10)23(36)26(12,39)24(37)18(22(19)35)25(28)38/h8,10,12,19,29,33-34,37,39H,4-7,9H2,1-3H3,(H2,28,38)(H,30,32)/t10-,12-,19-,26-/m0/s1 |
| InChIKey | LRTXHHYJLQYVFF-NXHKEXIGSA-N |
| XLogP | -0.72 |
| TPSA | 211.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.55 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|