About 2-[3-[3-[3,3-diphenylpropyl-(4-methoxybenzoyl)amino]propyl]phenoxy]acetic acid
2-[3-[3-[3,3-diphenylpropyl-(4-methoxybenzoyl)amino]propyl]phenoxy]acetic acid (PubChem CID 56951184) has the molecular formula C34H35NO5
and a molecular weight of 537.66 g/mol. Its IUPAC name is 2-[3-[3-[3,3-diphenylpropyl-(4-methoxybenzoyl)amino]propyl]phenoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[3-[3-[3,3-diphenylpropyl-(4-methoxybenzoyl)amino]propyl]phenoxy]acetic acid |
| PubChem CID | 56951184 |
| Molecular Formula | C34H35NO5 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | 2-[3-[3-[3,3-diphenylpropyl-(4-methoxybenzoyl)amino]propyl]phenoxy]acetic acid |
| SMILES | COc1ccc(C(=O)N(CCCc2cccc(OCC(=O)O)c2)CCC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H35NO5/c1-39-30-19-17-29(18-20-30)34(38)35(22-9-11-26-10-8-16-31(24-26)40-25-33(36)37)23-21-32(27-12-4-2-5-13-27)28-14-6-3-7-15-28/h2-8,10,12-20,24,32H,9,11,21-23,25H2,1H3,(H,36,37) |
| InChIKey | LNXLQFQNRWWWLC-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-[3-[3,3-diphenylpropyl-(4-methoxybenzoyl)amino]propyl]phenoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[3-[3,3-diphenylpropyl-(4-methoxybenzoyl)amino]propyl]phenoxy]acetic acid?
The IUPAC name of 2-[3-[3-[3,3-diphenylpropyl-(4-methoxybenzoyl)amino]propyl]phenoxy]acetic acid (CID 56951184) is 2-[3-[3-[3,3-diphenylpropyl-(4-methoxybenzoyl)amino]propyl]phenoxy]acetic acid.
What is the SMILES notation for 2-[3-[3-[3,3-diphenylpropyl-(4-methoxybenzoyl)amino]propyl]phenoxy]acetic acid?
The canonical SMILES for 2-[3-[3-[3,3-diphenylpropyl-(4-methoxybenzoyl)amino]propyl]phenoxy]acetic acid is COc1ccc(C(=O)N(CCCc2cccc(OCC(=O)O)c2)CCC(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-[3-[3-[3,3-diphenylpropyl-(4-methoxybenzoyl)amino]propyl]phenoxy]acetic acid?
The InChIKey is LNXLQFQNRWWWLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H35NO5/c1-39-30-19-17-29(18-20-30)34(38)35(22-9-11-26-10-8-16-31(24-26)40-25-33(36)37)23-21-32(27-12-4-2-5-13-27)28-14-6-3-7-15-28/h2-8,10,12-20,24,32H,9,11,21-23,25H2,1H3,(H,36,37).
What are the key properties of 2-[3-[3-[3,3-diphenylpropyl-(4-methoxybenzoyl)amino]propyl]phenoxy]acetic acid?
2-[3-[3-[3,3-diphenylpropyl-(4-methoxybenzoyl)amino]propyl]phenoxy]acetic acid has a molecular weight of 537.66 g/mol, XLogP of 6.46, 14 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[3-[3,3-diphenylpropyl-(4-methoxybenzoyl)amino]propyl]phenoxy]acetic acid is sourced from PubChem (CID 56951184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).