C20H21F3N6O3 — CID 56951430
2-[[2-[(1,3-dimethylpyrazol-4-yl)amino]-5-(trifluoromethyl)-4-pyridinyl]amino]-N,6-dimethoxybenzamide (PubChem CID 56951430) has the molecular formula C20H21F3N6O3 and a molecular weight of 450.42 g/mol. Its IUPAC name is 2-[[2-[(1,3-dimethylpyrazol-4-yl)amino]-5-(trifluoromethyl)-4-pyridinyl]amino]-N,6-dimethoxybenzamide.
| Compound Name | 2-[[2-[(1,3-dimethylpyrazol-4-yl)amino]-5-(trifluoromethyl)-4-pyridinyl]amino]-N,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 56951430 |
| Molecular Formula | C20H21F3N6O3 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2-[[2-[(1,3-dimethylpyrazol-4-yl)amino]-5-(trifluoromethyl)-4-pyridinyl]amino]-N,6-dimethoxybenzamide |
| SMILES | CONC(=O)c1c(Nc2cc(Nc3cn(C)nc3C)ncc2C(F)(F)F)cccc1OC |
| InChI | InChI=1S/C20H21F3N6O3/c1-11-15(10-29(2)27-11)26-17-8-14(12(9-24-17)20(21,22)23)25-13-6-5-7-16(31-3)18(13)19(30)28-32-4/h5-10H,1-4H3,(H,28,30)(H2,24,25,26) |
| InChIKey | IGVVOBUNWCCWCF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 102.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|