C24H22N4O4 — CID 56951625
4-[3-[[3-(1-methyl-2-oxo-3H-imidazo[4,5-b]pyridin-6-yl)benzoyl]amino]propyl]benzoic acid (PubChem CID 56951625) has the molecular formula C24H22N4O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is 4-[3-[[3-(1-methyl-2-oxo-3H-imidazo[4,5-b]pyridin-6-yl)benzoyl]amino]propyl]benzoic acid.
| Compound Name | 4-[3-[[3-(1-methyl-2-oxo-3H-imidazo[4,5-b]pyridin-6-yl)benzoyl]amino]propyl]benzoic acid |
|---|---|
| PubChem CID | 56951625 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 4-[3-[[3-(1-methyl-2-oxo-3H-imidazo[4,5-b]pyridin-6-yl)benzoyl]amino]propyl]benzoic acid |
| SMILES | Cn1c(=O)[nH]c2ncc(-c3cccc(C(=O)NCCCc4ccc(C(=O)O)cc4)c3)cc21 |
| InChI | InChI=1S/C24H22N4O4/c1-28-20-13-19(14-26-21(20)27-24(28)32)17-5-2-6-18(12-17)22(29)25-11-3-4-15-7-9-16(10-8-15)23(30)31/h2,5-10,12-14H,3-4,11H2,1H3,(H,25,29)(H,30,31)(H,26,27,32) |
| InChIKey | IZXBTKLQMRWWLH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 117.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|