C25H27F6N5O — CID 56951672
[4-[2-[3-(1H-benzimidazol-2-yl)propylamino]ethyl]piperazin-1-yl]-[3,5-bis(trifluoromethyl)phenyl]methanone (PubChem CID 56951672) has the molecular formula C25H27F6N5O and a molecular weight of 527.51 g/mol. Its IUPAC name is [4-[2-[3-(1H-benzimidazol-2-yl)propylamino]ethyl]piperazin-1-yl]-[3,5-bis(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-[2-[3-(1H-benzimidazol-2-yl)propylamino]ethyl]piperazin-1-yl]-[3,5-bis(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 56951672 |
| Molecular Formula | C25H27F6N5O |
| Molecular Weight | 527.51 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | [4-[2-[3-(1H-benzimidazol-2-yl)propylamino]ethyl]piperazin-1-yl]-[3,5-bis(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCN(CCNCCCc2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C25H27F6N5O/c26-24(27,28)18-14-17(15-19(16-18)25(29,30)31)23(37)36-12-10-35(11-13-36)9-8-32-7-3-6-22-33-20-4-1-2-5-21(20)34-22/h1-2,4-5,14-16,32H,3,6-13H2,(H,33,34) |
| InChIKey | OSZUJJYEPLOVTD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|