C22H20ClNO4S2 — CID 56951813
(4-chlorophenyl)-[4-(4-methylsulfonylphenyl)-5-morpholin-4-ylthiophen-2-yl]methanone (PubChem CID 56951813) has the molecular formula C22H20ClNO4S2 and a molecular weight of 461.99 g/mol. Its IUPAC name is (4-chlorophenyl)-[4-(4-methylsulfonylphenyl)-5-morpholin-4-ylthiophen-2-yl]methanone.
| Compound Name | (4-chlorophenyl)-[4-(4-methylsulfonylphenyl)-5-morpholin-4-ylthiophen-2-yl]methanone |
|---|---|
| PubChem CID | 56951813 |
| Molecular Formula | C22H20ClNO4S2 |
| Molecular Weight | 461.99 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | (4-chlorophenyl)-[4-(4-methylsulfonylphenyl)-5-morpholin-4-ylthiophen-2-yl]methanone |
| SMILES | CS(=O)(=O)c1ccc(-c2cc(C(=O)c3ccc(Cl)cc3)sc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H20ClNO4S2/c1-30(26,27)18-8-4-15(5-9-18)19-14-20(21(25)16-2-6-17(23)7-3-16)29-22(19)24-10-12-28-13-11-24/h2-9,14H,10-13H2,1H3 |
| InChIKey | SPTCMGLOJXTXSR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.99 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |