C22H31FN4O — CID 56951857
6-[[(3R,4R)-4-[2-[[(2S)-1-(3-fluorophenyl)propan-2-yl]amino]ethoxy]pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine (PubChem CID 56951857) has the molecular formula C22H31FN4O and a molecular weight of 386.52 g/mol. Its IUPAC name is 6-[[(3R,4R)-4-[2-[[(2S)-1-(3-fluorophenyl)propan-2-yl]amino]ethoxy]pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine.
| Compound Name | 6-[[(3R,4R)-4-[2-[[(2S)-1-(3-fluorophenyl)propan-2-yl]amino]ethoxy]pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 56951857 |
| Molecular Formula | C22H31FN4O |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 6-[[(3R,4R)-4-[2-[[(2S)-1-(3-fluorophenyl)propan-2-yl]amino]ethoxy]pyrrolidin-3-yl]methyl]-4-methylpyridin-2-amine |
| SMILES | Cc1cc(N)nc(C[C@@H]2CNC[C@@H]2OCCN[C@@H](C)Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C22H31FN4O/c1-15-8-20(27-22(24)9-15)12-18-13-25-14-21(18)28-7-6-26-16(2)10-17-4-3-5-19(23)11-17/h3-5,8-9,11,16,18,21,25-26H,6-7,10,12-14H2,1-2H3,(H2,24,27)/t16-,18+,21-/m0/s1 |
| InChIKey | AUSIEXNWJKDTQY-CDXJDZJCSA-N |
| XLogP | 2.48 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|