About N-benzoyl-N',N'-dimethylbenzohydrazide
N-benzoyl-N',N'-dimethylbenzohydrazide (PubChem CID 569523) has the molecular formula C16H16N2O2
and a molecular weight of 268.32 g/mol. Its IUPAC name is N-benzoyl-N',N'-dimethylbenzohydrazide.
Molecular Properties
| Compound Name | N-benzoyl-N',N'-dimethylbenzohydrazide |
| PubChem CID | 569523 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-benzoyl-N',N'-dimethylbenzohydrazide |
| SMILES | CN(C)N(C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H16N2O2/c1-17(2)18(15(19)13-9-5-3-6-10-13)16(20)14-11-7-4-8-12-14/h3-12H,1-2H3 |
| InChIKey | CZEOKQWKDUVLGB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-benzoyl-N',N'-dimethylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzoyl-N',N'-dimethylbenzohydrazide?
The IUPAC name of N-benzoyl-N',N'-dimethylbenzohydrazide (CID 569523) is N-benzoyl-N',N'-dimethylbenzohydrazide.
What is the SMILES notation for N-benzoyl-N',N'-dimethylbenzohydrazide?
The canonical SMILES for N-benzoyl-N',N'-dimethylbenzohydrazide is CN(C)N(C(=O)c1ccccc1)C(=O)c1ccccc1.
What is the InChIKey of N-benzoyl-N',N'-dimethylbenzohydrazide?
The InChIKey is CZEOKQWKDUVLGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2/c1-17(2)18(15(19)13-9-5-3-6-10-13)16(20)14-11-7-4-8-12-14/h3-12H,1-2H3.
What are the key properties of N-benzoyl-N',N'-dimethylbenzohydrazide?
N-benzoyl-N',N'-dimethylbenzohydrazide has a molecular weight of 268.32 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzoyl-N',N'-dimethylbenzohydrazide is sourced from PubChem (CID 569523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).