About 1-[2-(2-chloro-4-cyano-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]-3-methylurea
1-[2-(2-chloro-4-cyano-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]-3-methylurea (PubChem CID 56952315) has the molecular formula C15H9ClFN5OS
and a molecular weight of 361.79 g/mol. Its IUPAC name is 1-[2-(2-chloro-4-cyano-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]-3-methylurea.
Molecular Properties
| Compound Name | 1-[2-(2-chloro-4-cyano-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]-3-methylurea |
| PubChem CID | 56952315 |
| Molecular Formula | C15H9ClFN5OS |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 1-[2-(2-chloro-4-cyano-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]-3-methylurea |
| SMILES | CNC(=O)Nc1nccc2nc(-c3c(F)cc(C#N)cc3Cl)sc12 |
| InChI | InChI=1S/C15H9ClFN5OS/c1-19-15(23)22-13-12-10(2-3-20-13)21-14(24-12)11-8(16)4-7(6-18)5-9(11)17/h2-5H,1H3,(H2,19,20,22,23) |
| InChIKey | HONQJKPXGLDZHR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-(2-chloro-4-cyano-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2-chloro-4-cyano-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]-3-methylurea?
The IUPAC name of 1-[2-(2-chloro-4-cyano-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]-3-methylurea (CID 56952315) is 1-[2-(2-chloro-4-cyano-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]-3-methylurea.
What is the SMILES notation for 1-[2-(2-chloro-4-cyano-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]-3-methylurea?
The canonical SMILES for 1-[2-(2-chloro-4-cyano-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]-3-methylurea is CNC(=O)Nc1nccc2nc(-c3c(F)cc(C#N)cc3Cl)sc12.
What is the InChIKey of 1-[2-(2-chloro-4-cyano-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]-3-methylurea?
The InChIKey is HONQJKPXGLDZHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9ClFN5OS/c1-19-15(23)22-13-12-10(2-3-20-13)21-14(24-12)11-8(16)4-7(6-18)5-9(11)17/h2-5H,1H3,(H2,19,20,22,23).
What are the key properties of 1-[2-(2-chloro-4-cyano-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]-3-methylurea?
1-[2-(2-chloro-4-cyano-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]-3-methylurea has a molecular weight of 361.79 g/mol, XLogP of 3.77, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2-chloro-4-cyano-6-fluorophenyl)-[1,3]thiazolo[5,4-c]pyridin-4-yl]-3-methylurea is sourced from PubChem (CID 56952315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).