About 2-(2-chloro-6-fluorophenyl)-N-(4-methyl-2-pyridinyl)-[1,3]thiazolo[5,4-c]pyridin-4-amine
2-(2-chloro-6-fluorophenyl)-N-(4-methyl-2-pyridinyl)-[1,3]thiazolo[5,4-c]pyridin-4-amine (PubChem CID 56952318) has the molecular formula C18H12ClFN4S
and a molecular weight of 370.84 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-(4-methyl-2-pyridinyl)-[1,3]thiazolo[5,4-c]pyridin-4-amine.
Molecular Properties
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-(4-methyl-2-pyridinyl)-[1,3]thiazolo[5,4-c]pyridin-4-amine |
| PubChem CID | 56952318 |
| Molecular Formula | C18H12ClFN4S |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-(4-methyl-2-pyridinyl)-[1,3]thiazolo[5,4-c]pyridin-4-amine |
| SMILES | Cc1ccnc(Nc2nccc3nc(-c4c(F)cccc4Cl)sc23)c1 |
| InChI | InChI=1S/C18H12ClFN4S/c1-10-5-7-21-14(9-10)24-17-16-13(6-8-22-17)23-18(25-16)15-11(19)3-2-4-12(15)20/h2-9H,1H3,(H,21,22,24) |
| InChIKey | REKKFIVMVJOPAV-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-chloro-6-fluorophenyl)-N-(4-methyl-2-pyridinyl)-[1,3]thiazolo[5,4-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloro-6-fluorophenyl)-N-(4-methyl-2-pyridinyl)-[1,3]thiazolo[5,4-c]pyridin-4-amine?
The IUPAC name of 2-(2-chloro-6-fluorophenyl)-N-(4-methyl-2-pyridinyl)-[1,3]thiazolo[5,4-c]pyridin-4-amine (CID 56952318) is 2-(2-chloro-6-fluorophenyl)-N-(4-methyl-2-pyridinyl)-[1,3]thiazolo[5,4-c]pyridin-4-amine.
What is the SMILES notation for 2-(2-chloro-6-fluorophenyl)-N-(4-methyl-2-pyridinyl)-[1,3]thiazolo[5,4-c]pyridin-4-amine?
The canonical SMILES for 2-(2-chloro-6-fluorophenyl)-N-(4-methyl-2-pyridinyl)-[1,3]thiazolo[5,4-c]pyridin-4-amine is Cc1ccnc(Nc2nccc3nc(-c4c(F)cccc4Cl)sc23)c1.
What is the InChIKey of 2-(2-chloro-6-fluorophenyl)-N-(4-methyl-2-pyridinyl)-[1,3]thiazolo[5,4-c]pyridin-4-amine?
The InChIKey is REKKFIVMVJOPAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12ClFN4S/c1-10-5-7-21-14(9-10)24-17-16-13(6-8-22-17)23-18(25-16)15-11(19)3-2-4-12(15)20/h2-9H,1H3,(H,21,22,24).
What are the key properties of 2-(2-chloro-6-fluorophenyl)-N-(4-methyl-2-pyridinyl)-[1,3]thiazolo[5,4-c]pyridin-4-amine?
2-(2-chloro-6-fluorophenyl)-N-(4-methyl-2-pyridinyl)-[1,3]thiazolo[5,4-c]pyridin-4-amine has a molecular weight of 370.84 g/mol, XLogP of 5.60, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloro-6-fluorophenyl)-N-(4-methyl-2-pyridinyl)-[1,3]thiazolo[5,4-c]pyridin-4-amine is sourced from PubChem (CID 56952318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).