About 7-chloro-2,3-bis(ethylamino)quinoxaline-6-carbonitrile
7-chloro-2,3-bis(ethylamino)quinoxaline-6-carbonitrile (PubChem CID 56952331) has the molecular formula C13H14ClN5
and a molecular weight of 275.74 g/mol. Its IUPAC name is 7-chloro-2,3-bis(ethylamino)quinoxaline-6-carbonitrile.
Molecular Properties
| Compound Name | 7-chloro-2,3-bis(ethylamino)quinoxaline-6-carbonitrile |
| PubChem CID | 56952331 |
| Molecular Formula | C13H14ClN5 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 7-chloro-2,3-bis(ethylamino)quinoxaline-6-carbonitrile |
| SMILES | CCNc1nc2cc(Cl)c(C#N)cc2nc1NCC |
| InChI | InChI=1S/C13H14ClN5/c1-3-16-12-13(17-4-2)19-11-6-9(14)8(7-15)5-10(11)18-12/h5-6H,3-4H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | BBIXVRMJCBOHCO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-chloro-2,3-bis(ethylamino)quinoxaline-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2,3-bis(ethylamino)quinoxaline-6-carbonitrile?
The IUPAC name of 7-chloro-2,3-bis(ethylamino)quinoxaline-6-carbonitrile (CID 56952331) is 7-chloro-2,3-bis(ethylamino)quinoxaline-6-carbonitrile.
What is the SMILES notation for 7-chloro-2,3-bis(ethylamino)quinoxaline-6-carbonitrile?
The canonical SMILES for 7-chloro-2,3-bis(ethylamino)quinoxaline-6-carbonitrile is CCNc1nc2cc(Cl)c(C#N)cc2nc1NCC.
What is the InChIKey of 7-chloro-2,3-bis(ethylamino)quinoxaline-6-carbonitrile?
The InChIKey is BBIXVRMJCBOHCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClN5/c1-3-16-12-13(17-4-2)19-11-6-9(14)8(7-15)5-10(11)18-12/h5-6H,3-4H2,1-2H3,(H,16,18)(H,17,19).
What are the key properties of 7-chloro-2,3-bis(ethylamino)quinoxaline-6-carbonitrile?
7-chloro-2,3-bis(ethylamino)quinoxaline-6-carbonitrile has a molecular weight of 275.74 g/mol, XLogP of 3.02, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2,3-bis(ethylamino)quinoxaline-6-carbonitrile is sourced from PubChem (CID 56952331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).