C28H36Br2O3 — CID 56952343
6,14-bis(3-bromopropyl)-4,12-ditert-butyl-8,16,17-trioxatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene (PubChem CID 56952343) has the molecular formula C28H36Br2O3 and a molecular weight of 580.40 g/mol. Its IUPAC name is 6,14-bis(3-bromopropyl)-4,12-ditert-butyl-8,16,17-trioxatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene.
| Compound Name | 6,14-bis(3-bromopropyl)-4,12-ditert-butyl-8,16,17-trioxatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene |
|---|---|
| PubChem CID | 56952343 |
| Molecular Formula | C28H36Br2O3 |
| Molecular Weight | 580.40 g/mol |
| Exact Mass | 578.10 |
| IUPAC Name | 6,14-bis(3-bromopropyl)-4,12-ditert-butyl-8,16,17-trioxatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene |
| SMILES | CC(C)(C)c1cc(CCCBr)c2c(c1)C1Oc3c(CCCBr)cc(C(C)(C)C)cc3C(O2)O1 |
| InChI | InChI=1S/C28H36Br2O3/c1-27(2,3)19-13-17(9-7-11-29)23-21(15-19)25-32-24-18(10-8-12-30)14-20(28(4,5)6)16-22(24)26(31-23)33-25/h13-16,25-26H,7-12H2,1-6H3 |
| InChIKey | KVWKQXQAZKWEKB-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.40 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|