C17H17Cl2F2NO4 — CID 56952380
(3aR,6aS)-3a-(3,4-dichlorophenyl)-5,5-difluoro-1,2,3,4,6,6a-hexahydrocyclopenta[c]pyrrole;(E)-but-2-enedioic acid (PubChem CID 56952380) has the molecular formula C17H17Cl2F2NO4 and a molecular weight of 408.23 g/mol. Its IUPAC name is (3aR,6aS)-3a-(3,4-dichlorophenyl)-5,5-difluoro-1,2,3,4,6,6a-hexahydrocyclopenta[c]pyrrole;(E)-but-2-enedioic acid.
| Compound Name | (3aR,6aS)-3a-(3,4-dichlorophenyl)-5,5-difluoro-1,2,3,4,6,6a-hexahydrocyclopenta[c]pyrrole;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 56952380 |
| Molecular Formula | C17H17Cl2F2NO4 |
| Molecular Weight | 408.23 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | (3aR,6aS)-3a-(3,4-dichlorophenyl)-5,5-difluoro-1,2,3,4,6,6a-hexahydrocyclopenta[c]pyrrole;(E)-but-2-enedioic acid |
| SMILES | FC1(F)C[C@@H]2CNC[C@]2(c2ccc(Cl)c(Cl)c2)C1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C13H13Cl2F2N.C4H4O4/c14-10-2-1-8(3-11(10)15)12-6-13(16,17)4-9(12)5-18-7-12;5-3(6)1-2-4(7)8/h1-3,9,18H,4-7H2;1-2H,(H,5,6)(H,7,8)/b;2-1+/t9-,12+;/m1./s1 |
| InChIKey | AKVCAVGTSAWZBU-MKBCNHKISA-N |
| XLogP | 3.59 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.23 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|