About 5-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]pent-4-ynenitrile
5-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]pent-4-ynenitrile (PubChem CID 56952736) has the molecular formula C17H18ClN5
and a molecular weight of 327.82 g/mol. Its IUPAC name is 5-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]pent-4-ynenitrile.
Molecular Properties
| Compound Name | 5-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]pent-4-ynenitrile |
| PubChem CID | 56952736 |
| Molecular Formula | C17H18ClN5 |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 5-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]pent-4-ynenitrile |
| SMILES | CCNc1nc2cc(Cl)c(C#CCCC#N)cc2nc1NCC |
| InChI | InChI=1S/C17H18ClN5/c1-3-20-16-17(21-4-2)23-15-11-13(18)12(10-14(15)22-16)8-6-5-7-9-19/h10-11H,3-5,7H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | SJIXZYOHBXBQEL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]pent-4-ynenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]pent-4-ynenitrile?
The IUPAC name of 5-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]pent-4-ynenitrile (CID 56952736) is 5-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]pent-4-ynenitrile.
What is the SMILES notation for 5-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]pent-4-ynenitrile?
The canonical SMILES for 5-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]pent-4-ynenitrile is CCNc1nc2cc(Cl)c(C#CCCC#N)cc2nc1NCC.
What is the InChIKey of 5-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]pent-4-ynenitrile?
The InChIKey is SJIXZYOHBXBQEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18ClN5/c1-3-20-16-17(21-4-2)23-15-11-13(18)12(10-14(15)22-16)8-6-5-7-9-19/h10-11H,3-5,7H2,1-2H3,(H,20,22)(H,21,23).
What are the key properties of 5-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]pent-4-ynenitrile?
5-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]pent-4-ynenitrile has a molecular weight of 327.82 g/mol, XLogP of 3.80, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[7-chloro-2,3-bis(ethylamino)quinoxalin-6-yl]pent-4-ynenitrile is sourced from PubChem (CID 56952736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).