C21H17Cl3F6N4O — CID 56952790
1-[(E)-[2-chloro-4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]methylideneamino]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 56952790) has the molecular formula C21H17Cl3F6N4O and a molecular weight of 561.74 g/mol. Its IUPAC name is 1-[(E)-[2-chloro-4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]methylideneamino]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[(E)-[2-chloro-4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]methylideneamino]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 56952790 |
| Molecular Formula | C21H17Cl3F6N4O |
| Molecular Weight | 561.74 g/mol |
| Exact Mass | 560.04 |
| IUPAC Name | 1-[(E)-[2-chloro-4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]methylideneamino]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)N/N=C/c1ccc(N2CCC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1Cl |
| InChI | InChI=1S/C21H17Cl3F6N4O/c22-14-5-13(6-15(23)7-14)19(21(28,29)30)3-4-34(11-19)16-2-1-12(17(24)8-16)9-32-33-18(35)31-10-20(25,26)27/h1-2,5-9H,3-4,10-11H2,(H2,31,33,35)/b32-9+ |
| InChIKey | VCTTVEFTPUONOK-QILCKVHPSA-N |
| XLogP | 6.55 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.74 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|