C24H22Cl2N4O2 — CID 56952948
2,6-bis(4-chlorophenyl)-5-(2-morpholin-4-ylethyl)pyrazolo[1,5-a]pyrazin-4-one (PubChem CID 56952948) has the molecular formula C24H22Cl2N4O2 and a molecular weight of 469.37 g/mol. Its IUPAC name is 2,6-bis(4-chlorophenyl)-5-(2-morpholin-4-ylethyl)pyrazolo[1,5-a]pyrazin-4-one.
| Compound Name | 2,6-bis(4-chlorophenyl)-5-(2-morpholin-4-ylethyl)pyrazolo[1,5-a]pyrazin-4-one |
|---|---|
| PubChem CID | 56952948 |
| Molecular Formula | C24H22Cl2N4O2 |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 2,6-bis(4-chlorophenyl)-5-(2-morpholin-4-ylethyl)pyrazolo[1,5-a]pyrazin-4-one |
| SMILES | O=c1c2cc(-c3ccc(Cl)cc3)nn2cc(-c2ccc(Cl)cc2)n1CCN1CCOCC1 |
| InChI | InChI=1S/C24H22Cl2N4O2/c25-19-5-1-17(2-6-19)21-15-22-24(31)29(10-9-28-11-13-32-14-12-28)23(16-30(22)27-21)18-3-7-20(26)8-4-18/h1-8,15-16H,9-14H2 |
| InChIKey | AEHVYKAPRRHBPW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |