About 2-prop-2-enoyloxyethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate
2-prop-2-enoyloxyethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate (PubChem CID 56952951) has the molecular formula C9H8F6O5
and a molecular weight of 310.15 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate.
Molecular Properties
| Compound Name | 2-prop-2-enoyloxyethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate |
| PubChem CID | 56952951 |
| Molecular Formula | C9H8F6O5 |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 2-prop-2-enoyloxyethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate |
| SMILES | C=CC(=O)OCCOC(=O)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H8F6O5/c1-2-5(16)19-3-4-20-6(17)7(18,8(10,11)12)9(13,14)15/h2,18H,1,3-4H2 |
| InChIKey | IAAWBQNTLSHMJS-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enoyloxyethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enoyloxyethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate?
The IUPAC name of 2-prop-2-enoyloxyethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate (CID 56952951) is 2-prop-2-enoyloxyethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate.
What is the SMILES notation for 2-prop-2-enoyloxyethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate?
The canonical SMILES for 2-prop-2-enoyloxyethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate is C=CC(=O)OCCOC(=O)C(O)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 2-prop-2-enoyloxyethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate?
The InChIKey is IAAWBQNTLSHMJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F6O5/c1-2-5(16)19-3-4-20-6(17)7(18,8(10,11)12)9(13,14)15/h2,18H,1,3-4H2.
What are the key properties of 2-prop-2-enoyloxyethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate?
2-prop-2-enoyloxyethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate has a molecular weight of 310.15 g/mol, XLogP of 1.11, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enoyloxyethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate is sourced from PubChem (CID 56952951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).