C14H17Cl2NO — CID 56953452
(3aS,5S,6aS)-3a-(3,4-dichlorophenyl)-5-methoxy-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 56953452) has the molecular formula C14H17Cl2NO and a molecular weight of 286.20 g/mol. Its IUPAC name is (3aS,5S,6aS)-3a-(3,4-dichlorophenyl)-5-methoxy-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | (3aS,5S,6aS)-3a-(3,4-dichlorophenyl)-5-methoxy-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 56953452 |
| Molecular Formula | C14H17Cl2NO |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | (3aS,5S,6aS)-3a-(3,4-dichlorophenyl)-5-methoxy-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | CO[C@H]1C[C@@H]2CNC[C@@]2(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H17Cl2NO/c1-18-11-4-10-7-17-8-14(10,6-11)9-2-3-12(15)13(16)5-9/h2-3,5,10-11,17H,4,6-8H2,1H3/t10-,11+,14-/m1/s1 |
| InChIKey | ZMOWXXIASJXPNN-UHIISALHSA-N |
| XLogP | 3.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |