C30H39NO5 — CID 56953534
[(1S,2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 1-oxo-3,4-dihydroisoquinoline-2-carboxylate (PubChem CID 56953534) has the molecular formula C30H39NO5 and a molecular weight of 493.64 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 1-oxo-3,4-dihydroisoquinoline-2-carboxylate.
| Compound Name | [(1S,2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 1-oxo-3,4-dihydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 56953534 |
| Molecular Formula | C30H39NO5 |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 1-oxo-3,4-dihydroisoquinoline-2-carboxylate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)N2CCc3ccccc3C2=O)[C@@]2(C)C3C(=O)CC[C@@]3(CC[C@H]2C)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C30H39NO5/c1-6-28(4)17-23(36-27(35)31-16-13-20-9-7-8-10-21(20)26(31)34)29(5)18(2)11-14-30(19(3)25(28)33)15-12-22(32)24(29)30/h6-10,18-19,23-25,33H,1,11-17H2,2-5H3/t18-,19+,23-,24?,25+,28-,29+,30+/m1/s1 |
| InChIKey | OGUCGEZDVIBBAR-RPNBUUQBSA-N |
| XLogP | 5.18 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|